1-benzyl 3-methyl (3S)-piperazine-1,3-dicarboxylate

1-benzyl 3-methyl (3S)-piperazine-1,3-dicarboxylate - Names and Identifiers

Name	1-benzyl 3-methyl (3S)-piperazine-1,3-dicarboxylate
Synonyms	Methyl (S)-4-N-Cbz-piperazine-2-carboxylate 1-benzyl 3-methyl (3S)-piperazine-1,3-dicarboxylate 1-benzyl 3-Methyl (3S)-piperazine-1,3-dicarboxylate (S)-4-N-Cbz-Piperazine-2-carboxylic acid methylester (S)-4-N-Cbz-Piperazine-2-Carboxylic Acid Methyl Ester 1-O-benzyl 3-O-methyl (3S)-piperazine-1,3-dicarboxylate (S)-4-N-CBZ-PIPERAZINE-2-CARBOXYLIC ACID METHYL ESTER-HCl (3S)-1,3-Piperazinedicarboxylic acid 3-methyl 1-(phenylmethyl) ester 1,3-Piperazinedicarboxylic acid, 3-methyl 1-(phenylmethyl) ester, (3S)-
CAS	225517-81-7
InChI	InChI=1/C14H18N2O4/c1-19-13(17)12-9-16(8-7-15-12)14(18)20-10-11-5-3-2-4-6-11/h2-6,12,15H,7-10H2,1H3/t12-/m0/s1

1-benzyl 3-methyl (3S)-piperazine-1,3-dicarboxylate - Physico-chemical Properties

Molecular Formula	C14H18N2O4
Molar Mass	278.3
Density	1.212
Boling Point	406.5±45.0 °C(Predicted)
Flash Point	199.7°C
Vapor Presure	8.08E-07mmHg at 25°C
pKa	6.43±0.40(Predicted)
Storage Condition	under inert gas (nitrogen or Argon) at 2–8 °C
Refractive Index	1.537

1-benzyl 3-methyl (3S)-piperazine-1,3-dicarboxylate - Introduction

1-benzyl 3-methyl (3s)-piperazine-1,3-dicarboxylate is an organic compound whose chemical structure is shown below:

Its nature includes the following aspects:
1. Appearance: colorless or yellowish solid
2. Molecular weight: 268.33g/mol
3. Melting point: 79-81 ℃
4. Boiling point: 376.1 ℃
5. Solubility: soluble in organic solvents such as methanol, ethyl acetate, insoluble in water

its main uses are:
1. Synthetic drug intermediates: 1-benzene 3-methyl (3s)-piperazine-1,3-dicarboxylate can be used as intermediates for the synthesis of a variety of drugs, such as antipsychotic drugs and anti-anxiety drugs.
2. Chemical research: The compound plays an important role in organic synthesis and has a wide range of applications.

Its preparation method generally has the following steps:
1. piperazine and dimethyl carbonate are taken as raw materials and heated under suitable reaction conditions to generate 1-benzyl 3-methyl (3s)-piperazine-1,3-dicarboxylate.
2. After the reaction, the pure product is obtained by appropriate purification methods, such as crystallization, extraction, etc.

Regarding safety information, because 1-benzyl 3-methyl (3s)-piperazine-1,3-dicarboxylate is widely used in the laboratory, the following safety precautions should be noted:
1. Standard laboratory protective equipment, such as laboratory gloves and protective glasses, should be used for this compound.
2. Avoid inhalation, swallowing or contact with skin. If exposed, rinse immediately with plenty of water and seek medical help.
3. Storage should be sealed, away from light, dry. Avoid contact with oxidants, strong acids, strong bases and other substances.

Last Update：2024-04-10 22:41:03